C16H20N4O4 — CID 122319402
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-2-(3-methoxyphenoxy)acetamide (PubChem CID 122319402) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 122319402 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)Nc2cnc(OC)nc2N(C)C)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-20(2)15-13(9-17-16(19-15)23-4)18-14(21)10-24-12-7-5-6-11(8-12)22-3/h5-9H,10H2,1-4H3,(H,18,21) |
| InChIKey | TUEWJWMDDHKQDZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |