C14H16ClN5O2 — CID 122319316
1-(3-chlorophenyl)-3-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]urea (PubChem CID 122319316) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 122319316 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]urea |
| SMILES | COc1ncc(NC(=O)Nc2cccc(Cl)c2)c(N(C)C)n1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-20(2)12-11(8-16-14(19-12)22-3)18-13(21)17-10-6-4-5-9(15)7-10/h4-8H,1-3H3,(H2,17,18,21) |
| InChIKey | WPQXSWWCYDWEGS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |