C15H15N5O2 — CID 122319436
4-cyano-N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]benzamide (PubChem CID 122319436) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 4-cyano-N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]benzamide.
| Compound Name | 4-cyano-N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 122319436 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-cyano-N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]benzamide |
| SMILES | COc1ncc(NC(=O)c2ccc(C#N)cc2)c(N(C)C)n1 |
| InChI | InChI=1S/C15H15N5O2/c1-20(2)13-12(9-17-15(19-13)22-3)18-14(21)11-6-4-10(8-16)5-7-11/h4-7,9H,1-3H3,(H,18,21) |
| InChIKey | QEWWKRWEAWQGOA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |