C15H19N5O3 — CID 122319515
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-ethoxypyridine-3-carboxamide (PubChem CID 122319515) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-ethoxypyridine-3-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 122319515 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-ethoxypyridine-3-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2cnc(OC)nc2N(C)C)cn1 |
| InChI | InChI=1S/C15H19N5O3/c1-5-23-12-7-6-10(8-16-12)14(21)18-11-9-17-15(22-4)19-13(11)20(2)3/h6-9H,5H2,1-4H3,(H,18,21) |
| InChIKey | RZTJSODTNODNGN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |