C13H18N6O3 — CID 122319426
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 122319426) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122319426 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cn(C)nc2OC)c(N(C)C)n1 |
| InChI | InChI=1S/C13H18N6O3/c1-18(2)10-9(6-14-13(16-10)22-5)15-11(20)8-7-19(3)17-12(8)21-4/h6-7H,1-5H3,(H,15,20) |
| InChIKey | HQOJYDOWASAERV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |