C16H14FN5O3 — CID 122303009
N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 122303009) has the molecular formula C16H14FN5O3 and a molecular weight of 343.32 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122303009 |
| Molecular Formula | C16H14FN5O3 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)Nc1cnc(Oc2ccccc2F)nc1 |
| InChI | InChI=1S/C16H14FN5O3/c1-22-9-11(15(21-22)24-2)14(23)20-10-7-18-16(19-8-10)25-13-6-4-3-5-12(13)17/h3-9H,1-2H3,(H,20,23) |
| InChIKey | HJMSKNFXPSFGIG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |