C19H17FN4O4 — CID 122303190
1-(3,4-dimethoxyphenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea (PubChem CID 122303190) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 122303190 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cnc(Oc3ccccc3F)nc2)cc1OC |
| InChI | InChI=1S/C19H17FN4O4/c1-26-16-8-7-12(9-17(16)27-2)23-18(25)24-13-10-21-19(22-11-13)28-15-6-4-3-5-14(15)20/h3-11H,1-2H3,(H2,23,24,25) |
| InChIKey | NFZSZVQCYNGENC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |