C20H20N4O3 — CID 113020117
1-[6-(3,4-dimethoxyanilino)-3-pyridinyl]-3-phenylurea (PubChem CID 113020117) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[6-(3,4-dimethoxyanilino)-3-pyridinyl]-3-phenylurea.
| Compound Name | 1-[6-(3,4-dimethoxyanilino)-3-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 113020117 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[6-(3,4-dimethoxyanilino)-3-pyridinyl]-3-phenylurea |
| SMILES | COc1ccc(Nc2ccc(NC(=O)Nc3ccccc3)cn2)cc1OC |
| InChI | InChI=1S/C20H20N4O3/c1-26-17-10-8-15(12-18(17)27-2)22-19-11-9-16(13-21-19)24-20(25)23-14-6-4-3-5-7-14/h3-13H,1-2H3,(H,21,22)(H2,23,24,25) |
| InChIKey | CTIHYNIYDMMYGD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |