C21H21N3O4 — CID 109163977
6-(3,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-3-carboxamide (PubChem CID 109163977) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-(3,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(3,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109163977 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 6-(3,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccc(Nc3ccc(OC)c(OC)c3)nc2)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-26-17-6-4-5-15(11-17)24-21(25)14-7-10-20(22-13-14)23-16-8-9-18(27-2)19(12-16)28-3/h4-13H,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | PWXZYOVOBZUDTH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |