C22H23N3O2 — CID 109163087
N-(3-methoxyphenyl)-6-(2,4,6-trimethylanilino)pyridine-3-carboxamide (PubChem CID 109163087) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-6-(2,4,6-trimethylanilino)pyridine-3-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-6-(2,4,6-trimethylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109163087 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-(3-methoxyphenyl)-6-(2,4,6-trimethylanilino)pyridine-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccc(Nc3c(C)cc(C)cc3C)nc2)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-14-10-15(2)21(16(3)11-14)25-20-9-8-17(13-23-20)22(26)24-18-6-5-7-19(12-18)27-4/h5-13H,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | GMOXQKPIWWEOFX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |