C22H24N4O3 — CID 109164382
N-(3,4-dimethoxyphenyl)-6-[4-(dimethylamino)anilino]pyridine-3-carboxamide (PubChem CID 109164382) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-[4-(dimethylamino)anilino]pyridine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-[4-(dimethylamino)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109164382 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-[4-(dimethylamino)anilino]pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Nc3ccc(N(C)C)cc3)nc2)cc1OC |
| InChI | InChI=1S/C22H24N4O3/c1-26(2)18-9-6-16(7-10-18)24-21-12-5-15(14-23-21)22(27)25-17-8-11-19(28-3)20(13-17)29-4/h5-14H,1-4H3,(H,23,24)(H,25,27) |
| InChIKey | VAMOTENFYXVKLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|