C22H24N4O2 — CID 109157204
6-[4-(dimethylamino)anilino]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 109157204) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 6-[4-(dimethylamino)anilino]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-[4-(dimethylamino)anilino]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109157204 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 6-[4-(dimethylamino)anilino]-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1ccc(Nc2ccc(N(C)C)cc2)nc1 |
| InChI | InChI=1S/C22H24N4O2/c1-26(2)19-11-9-18(10-12-19)25-21-13-8-17(15-23-21)22(27)24-14-16-6-4-5-7-20(16)28-3/h4-13,15H,14H2,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | JAOPTDSOPAHIFH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|