C22H23N3O3 — CID 109157190
6-(4-ethoxyanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 109157190) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 6-(4-ethoxyanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-(4-ethoxyanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109157190 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 6-(4-ethoxyanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | CCOc1ccc(Nc2ccc(C(=O)NCc3ccccc3OC)cn2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-28-19-11-9-18(10-12-19)25-21-13-8-17(15-23-21)22(26)24-14-16-6-4-5-7-20(16)27-2/h4-13,15H,3,14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | FSATXNWVBRBAJO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |