C22H22N4O3 — CID 109164647
methyl 4-[[6-[4-(dimethylamino)anilino]pyridine-3-carbonyl]amino]benzoate (PubChem CID 109164647) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl 4-[[6-[4-(dimethylamino)anilino]pyridine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[6-[4-(dimethylamino)anilino]pyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109164647 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl 4-[[6-[4-(dimethylamino)anilino]pyridine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(Nc3ccc(N(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-26(2)19-11-9-17(10-12-19)24-20-13-6-16(14-23-20)21(27)25-18-7-4-15(5-8-18)22(28)29-3/h4-14H,1-3H3,(H,23,24)(H,25,27) |
| InChIKey | LUXDMDUUXGPNRL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|