C22H21N3O4 — CID 109164310
N-(3-acetylphenyl)-6-(2,5-dimethoxyanilino)pyridine-3-carboxamide (PubChem CID 109164310) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-6-(2,5-dimethoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(3-acetylphenyl)-6-(2,5-dimethoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109164310 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(3-acetylphenyl)-6-(2,5-dimethoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(OC)c(Nc2ccc(C(=O)Nc3cccc(C(C)=O)c3)cn2)c1 |
| InChI | InChI=1S/C22H21N3O4/c1-14(26)15-5-4-6-17(11-15)24-22(27)16-7-10-21(23-13-16)25-19-12-18(28-2)8-9-20(19)29-3/h4-13H,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | VNGIUBWUCPWBQW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |