C22H23N3O4 — CID 109159951
N-[(3,4-dimethoxyphenyl)methyl]-6-(3-methoxyanilino)pyridine-3-carboxamide (PubChem CID 109159951) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-6-(3-methoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-6-(3-methoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109159951 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-6-(3-methoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1cccc(Nc2ccc(C(=O)NCc3ccc(OC)c(OC)c3)cn2)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-27-18-6-4-5-17(12-18)25-21-10-8-16(14-23-21)22(26)24-13-15-7-9-19(28-2)20(11-15)29-3/h4-12,14H,13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | NOTAIGNUPXMUEE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |