C21H22N4O4 — CID 113048221
2-(3,4-dimethoxyphenyl)-N-[6-(3-methoxyanilino)pyridazin-3-yl]acetamide (PubChem CID 113048221) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[6-(3-methoxyanilino)pyridazin-3-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[6-(3-methoxyanilino)pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 113048221 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[6-(3-methoxyanilino)pyridazin-3-yl]acetamide |
| SMILES | COc1cccc(Nc2ccc(NC(=O)Cc3ccc(OC)c(OC)c3)nn2)c1 |
| InChI | InChI=1S/C21H22N4O4/c1-27-16-6-4-5-15(13-16)22-19-9-10-20(25-24-19)23-21(26)12-14-7-8-17(28-2)18(11-14)29-3/h4-11,13H,12H2,1-3H3,(H,22,24)(H,23,25,26) |
| InChIKey | HOMBZQVKTCMGJT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |