C17H21N3O3 — CID 113020075
N-[6-(3,4-dimethoxyanilino)-3-pyridinyl]butanamide (PubChem CID 113020075) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[6-(3,4-dimethoxyanilino)-3-pyridinyl]butanamide.
| Compound Name | N-[6-(3,4-dimethoxyanilino)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 113020075 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[6-(3,4-dimethoxyanilino)-3-pyridinyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Nc2ccc(OC)c(OC)c2)nc1 |
| InChI | InChI=1S/C17H21N3O3/c1-4-5-17(21)20-13-7-9-16(18-11-13)19-12-6-8-14(22-2)15(10-12)23-3/h6-11H,4-5H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | NTZAZIIQOOKLDN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |