C16H19N3O — CID 113016196
N-[6-(3-methylanilino)-3-pyridinyl]butanamide (PubChem CID 113016196) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N-[6-(3-methylanilino)-3-pyridinyl]butanamide.
| Compound Name | N-[6-(3-methylanilino)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 113016196 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-[6-(3-methylanilino)-3-pyridinyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Nc2cccc(C)c2)nc1 |
| InChI | InChI=1S/C16H19N3O/c1-3-5-16(20)19-14-8-9-15(17-11-14)18-13-7-4-6-12(2)10-13/h4,6-11H,3,5H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | RGADCFBGSLJOSU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |