C20H19ClN4O3 — CID 113022483
1-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]-3-phenylurea (PubChem CID 113022483) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is 1-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]-3-phenylurea.
| Compound Name | 1-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 113022483 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]-3-phenylurea |
| SMILES | COc1cc(Nc2ccc(NC(=O)Nc3ccccc3)cn2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H19ClN4O3/c1-27-17-11-16(18(28-2)10-15(17)21)25-19-9-8-14(12-22-19)24-20(26)23-13-6-4-3-5-7-13/h3-12H,1-2H3,(H,22,25)(H2,23,24,26) |
| InChIKey | PQEGHPJLANDNPB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |