C19H16FN3O4 — CID 91968353
N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3,4-dimethoxybenzamide (PubChem CID 91968353) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 91968353 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cnc(Oc3ccccc3F)nc2)cc1OC |
| InChI | InChI=1S/C19H16FN3O4/c1-25-16-8-7-12(9-17(16)26-2)18(24)23-13-10-21-19(22-11-13)27-15-6-4-3-5-14(15)20/h3-11H,1-2H3,(H,23,24) |
| InChIKey | QQYQJSRYJMRXFU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |