C21H18F2N2O3 — CID 112990211
N-[4-(2,6-difluoroanilino)phenyl]-3,4-dimethoxybenzamide (PubChem CID 112990211) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[4-(2,6-difluoroanilino)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-(2,6-difluoroanilino)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 112990211 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[4-(2,6-difluoroanilino)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Nc3c(F)cccc3F)cc2)cc1OC |
| InChI | InChI=1S/C21H18F2N2O3/c1-27-18-11-6-13(12-19(18)28-2)21(26)25-15-9-7-14(8-10-15)24-20-16(22)4-3-5-17(20)23/h3-12,24H,1-2H3,(H,25,26) |
| InChIKey | MKOKPFQHGIEPAS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |