C17H11F3N4O2 — CID 122302932
1-(3,5-difluorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea (PubChem CID 122302932) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 122302932 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea |
| SMILES | O=C(Nc1cnc(Oc2ccccc2F)nc1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H11F3N4O2/c18-10-5-11(19)7-12(6-10)23-16(25)24-13-8-21-17(22-9-13)26-15-4-2-1-3-14(15)20/h1-9H,(H2,23,24,25) |
| InChIKey | WBODFTVBCSKATQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |