C17H12ClFN4O2 — CID 71799863
1-(2-chlorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea (PubChem CID 71799863) has the molecular formula C17H12ClFN4O2 and a molecular weight of 358.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 71799863 |
| Molecular Formula | C17H12ClFN4O2 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(2-fluorophenoxy)pyrimidin-5-yl]urea |
| SMILES | O=C(Nc1cnc(Oc2ccccc2F)nc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H12ClFN4O2/c18-12-5-1-3-7-14(12)23-16(24)22-11-9-20-17(21-10-11)25-15-8-4-2-6-13(15)19/h1-10H,(H2,22,23,24) |
| InChIKey | MBHUHHGCKXPCAR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |