C18H12ClF2N3O2 — CID 122303113
2-(2-chloro-6-fluorophenyl)-N-[2-(2-fluorophenoxy)pyrimidin-5-yl]acetamide (PubChem CID 122303113) has the molecular formula C18H12ClF2N3O2 and a molecular weight of 375.76 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-(2-fluorophenoxy)pyrimidin-5-yl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-(2-fluorophenoxy)pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 122303113 |
| Molecular Formula | C18H12ClF2N3O2 |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-(2-fluorophenoxy)pyrimidin-5-yl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)Nc1cnc(Oc2ccccc2F)nc1 |
| InChI | InChI=1S/C18H12ClF2N3O2/c19-13-4-3-6-14(20)12(13)8-17(25)24-11-9-22-18(23-10-11)26-16-7-2-1-5-15(16)21/h1-7,9-10H,8H2,(H,24,25) |
| InChIKey | QTRHGLJBQLLFCT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |