C22H24N4O4 — CID 121079820
3-methoxy-N-[4-[2-(2-methoxyphenyl)ethylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 121079820) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-methoxy-N-[4-[2-(2-methoxyphenyl)ethylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-methoxy-N-[4-[2-(2-methoxyphenyl)ethylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121079820 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-methoxy-N-[4-[2-(2-methoxyphenyl)ethylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)c1ccc(NC(=O)c2cn(C)nc2OC)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-26-14-18(22(25-26)30-3)21(28)24-17-10-8-16(9-11-17)20(27)23-13-12-15-6-4-5-7-19(15)29-2/h4-11,14H,12-13H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | UGAZSCMUGTYWPR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |