C21H22N4O4 — CID 121079815
3-methoxy-N-[4-[(2-methoxyphenyl)methylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 121079815) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-methoxy-N-[4-[(2-methoxyphenyl)methylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-methoxy-N-[4-[(2-methoxyphenyl)methylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121079815 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-methoxy-N-[4-[(2-methoxyphenyl)methylcarbamoyl]phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1ccc(NC(=O)c2cn(C)nc2OC)cc1 |
| InChI | InChI=1S/C21H22N4O4/c1-25-13-17(21(24-25)29-3)20(27)23-16-10-8-14(9-11-16)19(26)22-12-15-6-4-5-7-18(15)28-2/h4-11,13H,12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | WPWODHFDBXLSAQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |