C19H14FN5O2S — CID 122303083
N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 122303083) has the molecular formula C19H14FN5O2S and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122303083 |
| Molecular Formula | C19H14FN5O2S |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[2-(2-fluorophenoxy)pyrimidin-5-yl]-1-methyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2cccs2)cc1C(=O)Nc1cnc(Oc2ccccc2F)nc1 |
| InChI | InChI=1S/C19H14FN5O2S/c1-25-15(9-14(24-25)17-7-4-8-28-17)18(26)23-12-10-21-19(22-11-12)27-16-6-3-2-5-13(16)20/h2-11H,1H3,(H,23,26) |
| InChIKey | KCSXZZVYHJQMRD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |