C14H14F3N5O2 — CID 122319457
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 122319457) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122319457 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1ncc(NC(=O)c2ccc(C(F)(F)F)nc2)c(N(C)C)n1 |
| InChI | InChI=1S/C14H14F3N5O2/c1-22(2)11-9(7-19-13(21-11)24-3)20-12(23)8-4-5-10(18-6-8)14(15,16)17/h4-7H,1-3H3,(H,20,23) |
| InChIKey | ONVLKBJKYDYAIL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |