C14H15ClN4O4 — CID 122303962
1-(5-chloro-2-methoxyphenyl)-3-(2,4-dimethoxypyrimidin-5-yl)urea (PubChem CID 122303962) has the molecular formula C14H15ClN4O4 and a molecular weight of 338.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(2,4-dimethoxypyrimidin-5-yl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(2,4-dimethoxypyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122303962 |
| Molecular Formula | C14H15ClN4O4 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(2,4-dimethoxypyrimidin-5-yl)urea |
| SMILES | COc1ncc(NC(=O)Nc2cc(Cl)ccc2OC)c(OC)n1 |
| InChI | InChI=1S/C14H15ClN4O4/c1-21-11-5-4-8(15)6-9(11)17-13(20)18-10-7-16-14(23-3)19-12(10)22-2/h4-7H,1-3H3,(H2,17,18,20) |
| InChIKey | FJGDKICCFOGRKX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |