C14H14ClN3O4 — CID 71807581
5-chloro-N-(2,4-dimethoxypyrimidin-5-yl)-2-methoxybenzamide (PubChem CID 71807581) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dimethoxypyrimidin-5-yl)-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(2,4-dimethoxypyrimidin-5-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 71807581 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-chloro-N-(2,4-dimethoxypyrimidin-5-yl)-2-methoxybenzamide |
| SMILES | COc1ncc(NC(=O)c2cc(Cl)ccc2OC)c(OC)n1 |
| InChI | InChI=1S/C14H14ClN3O4/c1-20-11-5-4-8(15)6-9(11)12(19)17-10-7-16-14(22-3)18-13(10)21-2/h4-7H,1-3H3,(H,17,19) |
| InChIKey | USMSNKJMCFYPCX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |