C17H15ClN4O2 — CID 52945092
1-(5-chloro-2-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-4-yl)urea (PubChem CID 52945092) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-4-yl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-4-yl)urea |
|---|---|
| PubChem CID | 52945092 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(2-methyl-1,8-naphthyridin-4-yl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1cc(C)nc2ncccc12 |
| InChI | InChI=1S/C17H15ClN4O2/c1-10-8-13(12-4-3-7-19-16(12)20-10)21-17(23)22-14-9-11(18)5-6-15(14)24-2/h3-9H,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | ANPBWIKLRHMGFH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |