C24H22N6O4 — CID 122299980
8-methoxy-2-oxo-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]chromene-3-carboxamide (PubChem CID 122299980) has the molecular formula C24H22N6O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 122299980 |
| Molecular Formula | C24H22N6O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 8-methoxy-2-oxo-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cnc(N4CCN(c5ccccn5)CC4)nc3)c(=O)oc12 |
| InChI | InChI=1S/C24H22N6O4/c1-33-19-6-4-5-16-13-18(23(32)34-21(16)19)22(31)28-17-14-26-24(27-15-17)30-11-9-29(10-12-30)20-7-2-3-8-25-20/h2-8,13-15H,9-12H2,1H3,(H,28,31) |
| InChIKey | ZGXBAOHIRZIQCT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|