C19H19N3O3 — CID 99715119
7-methoxy-N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide (PubChem CID 99715119) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 7-methoxy-N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 99715119 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 7-methoxy-N-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)N[C@@H]3CCN(c4ccccn4)C3)oc12 |
| InChI | InChI=1S/C19H19N3O3/c1-24-15-6-4-5-13-11-16(25-18(13)15)19(23)21-14-8-10-22(12-14)17-7-2-3-9-20-17/h2-7,9,11,14H,8,10,12H2,1H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | OYICJDVMKGEVAO-CQSZACIVSA-N |
| XLogP | 2.85 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |