C19H17N3O3 — CID 90621231
2-oxo-N-(1-pyridin-2-ylpyrrolidin-3-yl)chromene-3-carboxamide (PubChem CID 90621231) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-oxo-N-(1-pyridin-2-ylpyrrolidin-3-yl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(1-pyridin-2-ylpyrrolidin-3-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 90621231 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-oxo-N-(1-pyridin-2-ylpyrrolidin-3-yl)chromene-3-carboxamide |
| SMILES | O=C(NC1CCN(c2ccccn2)C1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H17N3O3/c23-18(15-11-13-5-1-2-6-16(13)25-19(15)24)21-14-8-10-22(12-14)17-7-3-4-9-20-17/h1-7,9,11,14H,8,10,12H2,(H,21,23) |
| InChIKey | VEVCXTUBFUSXCR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|