C23H24N2O3 — CID 45195643
2-oxo-N-[1-(2-phenylethyl)piperidin-3-yl]chromene-3-carboxamide (PubChem CID 45195643) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-oxo-N-[1-(2-phenylethyl)piperidin-3-yl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[1-(2-phenylethyl)piperidin-3-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 45195643 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-oxo-N-[1-(2-phenylethyl)piperidin-3-yl]chromene-3-carboxamide |
| SMILES | O=C(NC1CCCN(CCc2ccccc2)C1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H24N2O3/c26-22(20-15-18-9-4-5-11-21(18)28-23(20)27)24-19-10-6-13-25(16-19)14-12-17-7-2-1-3-8-17/h1-5,7-9,11,15,19H,6,10,12-14,16H2,(H,24,26) |
| InChIKey | LMRWELLROFQSET-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|