C20H16N2O4 — CID 16822106
2-oxo-N-(5-oxo-1-phenylpyrrolidin-3-yl)chromene-3-carboxamide (PubChem CID 16822106) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-oxo-N-(5-oxo-1-phenylpyrrolidin-3-yl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(5-oxo-1-phenylpyrrolidin-3-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 16822106 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-oxo-N-(5-oxo-1-phenylpyrrolidin-3-yl)chromene-3-carboxamide |
| SMILES | O=C(NC1CC(=O)N(c2ccccc2)C1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H16N2O4/c23-18-11-14(12-22(18)15-7-2-1-3-8-15)21-19(24)16-10-13-6-4-5-9-17(13)26-20(16)25/h1-10,14H,11-12H2,(H,21,24) |
| InChIKey | XAKRSVLGBZSYMQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|