C21H17FN2O4 — CID 42307840
N-[(3R)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 42307840) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is N-[(3R)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(3R)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 42307840 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(3R)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CC(=O)N(Cc2cccc(F)c2)C1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H17FN2O4/c22-15-6-3-4-13(8-15)11-24-12-16(10-19(24)25)23-20(26)17-9-14-5-1-2-7-18(14)28-21(17)27/h1-9,16H,10-12H2,(H,23,26)/t16-/m1/s1 |
| InChIKey | HZHGEFHZNHIECK-MRXNPFEDSA-N |
| XLogP | 2.46 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|