C16H15FN2O2S — CID 42094331
N-[(3S)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 42094331) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[(3S)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3S)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42094331 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(3S)-1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CC(=O)N(Cc2cccc(F)c2)C1)c1cccs1 |
| InChI | InChI=1S/C16H15FN2O2S/c17-12-4-1-3-11(7-12)9-19-10-13(8-15(19)20)18-16(21)14-5-2-6-22-14/h1-7,13H,8-10H2,(H,18,21)/t13-/m0/s1 |
| InChIKey | ZDQXOBRROBJLAM-ZDUSSCGKSA-N |
| XLogP | 2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |