C17H21FN2O2 — CID 45202640
N-[1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]cyclopentanecarboxamide (PubChem CID 45202640) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 45202640 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]-5-oxopyrrolidin-3-yl]cyclopentanecarboxamide |
| SMILES | O=C(NC1CC(=O)N(Cc2cccc(F)c2)C1)C1CCCC1 |
| InChI | InChI=1S/C17H21FN2O2/c18-14-7-3-4-12(8-14)10-20-11-15(9-16(20)21)19-17(22)13-5-1-2-6-13/h3-4,7-8,13,15H,1-2,5-6,9-11H2,(H,19,22) |
| InChIKey | QADKQTCNHJNZCH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |