C22H18N2O6 — CID 7564205
N-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 7564205) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is N-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7564205 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C22H18N2O6/c25-20-10-14(12-24(20)15-5-6-18-19(11-15)29-8-7-28-18)23-21(26)16-9-13-3-1-2-4-17(13)30-22(16)27/h1-6,9,11,14H,7-8,10,12H2,(H,23,26)/t14-/m1/s1 |
| InChIKey | DJXKJCIRCUERDG-CQSZACIVSA-N |
| XLogP | 2.10 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|