C20H18ClFN6O — CID 121112875
2-chloro-4-fluoro-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]benzamide (PubChem CID 121112875) has the molecular formula C20H18ClFN6O and a molecular weight of 412.86 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 121112875 |
| Molecular Formula | C20H18ClFN6O |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-chloro-4-fluoro-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]benzamide |
| SMILES | O=C(Nc1cnc(N2CCN(c3ccccn3)CC2)nc1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H18ClFN6O/c21-17-11-14(22)4-5-16(17)19(29)26-15-12-24-20(25-13-15)28-9-7-27(8-10-28)18-3-1-2-6-23-18/h1-6,11-13H,7-10H2,(H,26,29) |
| InChIKey | HMOKIPPFXWNKNN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |