C20H20FN7O — CID 121112892
1-(4-fluorophenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]urea (PubChem CID 121112892) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 121112892 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1cnc(N2CCN(c3ccccn3)CC2)nc1 |
| InChI | InChI=1S/C20H20FN7O/c21-15-4-6-16(7-5-15)25-20(29)26-17-13-23-19(24-14-17)28-11-9-27(10-12-28)18-3-1-2-8-22-18/h1-8,13-14H,9-12H2,(H2,25,26,29) |
| InChIKey | LUYGXDDZRNWKBV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |