C17H19N9O — CID 122300047
1-methyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]triazole-4-carboxamide (PubChem CID 122300047) has the molecular formula C17H19N9O and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-methyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]triazole-4-carboxamide.
| Compound Name | 1-methyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122300047 |
| Molecular Formula | C17H19N9O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-methyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-5-yl]triazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2cnc(N3CCN(c4ccccn4)CC3)nc2)nn1 |
| InChI | InChI=1S/C17H19N9O/c1-24-12-14(22-23-24)16(27)21-13-10-19-17(20-11-13)26-8-6-25(7-9-26)15-4-2-3-5-18-15/h2-5,10-12H,6-9H2,1H3,(H,21,27) |
| InChIKey | QMTXAJLGVVKJPL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |