C25H18N2O4 — CID 86650416
N-[3-(1H-indol-5-yl)phenyl]-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 86650416) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[3-(1H-indol-5-yl)phenyl]-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-(1H-indol-5-yl)phenyl]-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 86650416 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[3-(1H-indol-5-yl)phenyl]-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cccc(-c4ccc5[nH]ccc5c4)c3)c(=O)oc12 |
| InChI | InChI=1S/C25H18N2O4/c1-30-22-7-3-5-18-14-20(25(29)31-23(18)22)24(28)27-19-6-2-4-15(13-19)16-8-9-21-17(12-16)10-11-26-21/h2-14,26H,1H3,(H,27,28) |
| InChIKey | IHMDRWYRDGTOOF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|