C23H24FN5O — CID 46267964
2-fluoro-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide (PubChem CID 46267964) has the molecular formula C23H24FN5O and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-fluoro-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 46267964 |
| Molecular Formula | C23H24FN5O |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-fluoro-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)c3ccccc3F)cc2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H24FN5O/c1-16-25-21(15-22(26-16)29-13-5-2-6-14-29)27-17-9-11-18(12-10-17)28-23(30)19-7-3-4-8-20(19)24/h3-4,7-12,15H,2,5-6,13-14H2,1H3,(H,28,30)(H,25,26,27) |
| InChIKey | RKEDOCUVCWRBJI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |