C21H24F3N5O3 — CID 122340857
[4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone (PubChem CID 122340857) has the molecular formula C21H24F3N5O3 and a molecular weight of 451.45 g/mol. Its IUPAC name is [4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone.
| Compound Name | [4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 122340857 |
| Molecular Formula | C21H24F3N5O3 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
| SMILES | COc1c(F)c(F)cc(C(=O)N2CCN(c3cc(N4CCOCC4)nc(C)n3)CC2)c1F |
| InChI | InChI=1S/C21H24F3N5O3/c1-13-25-16(12-17(26-13)28-7-9-32-10-8-28)27-3-5-29(6-4-27)21(30)14-11-15(22)19(24)20(31-2)18(14)23/h11-12H,3-10H2,1-2H3 |
| InChIKey | DXBKWUHSEGVGDK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|