C20H22F3N5O2 — CID 122340045
[4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 122340045) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is [4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 122340045 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H22F3N5O2/c1-13-12-16(25-20(24-13)28-8-10-30-11-9-28)26-4-6-27(7-5-26)19(29)14-2-3-15(21)18(23)17(14)22/h2-3,12H,4-11H2,1H3 |
| InChIKey | PXSFNQAQLPGCCL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|