C21H26FN5O2 — CID 122333558
2-(2-fluorophenyl)-1-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethanone (PubChem CID 122333558) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122333558 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(N2CCOCC2)nc(N2CCN(C(=O)Cc3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C21H26FN5O2/c1-16-14-19(25-10-12-29-13-11-25)24-21(23-16)27-8-6-26(7-9-27)20(28)15-17-4-2-3-5-18(17)22/h2-5,14H,6-13,15H2,1H3 |
| InChIKey | RVJNEAVHAVKXFU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |