C22H35N5O2 — CID 121090195
3-cyclohexyl-1-[4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 121090195) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 3-cyclohexyl-1-[4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 121090195 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 3-cyclohexyl-1-[4-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)CCC3CCCCC3)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H35N5O2/c1-18-17-20(24-22(23-18)27-13-15-29-16-14-27)25-9-11-26(12-10-25)21(28)8-7-19-5-3-2-4-6-19/h17,19H,2-16H2,1H3 |
| InChIKey | CZPNICNDYLVDNM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |